CAS 480452-36-6 appears in our catalog under these names: Edoxaban Impurity 13 (1R,2S,5S), Edoxaban Impurity A, Edoxaban Impurity 9, Ethanediamide Impurity D, (1R, 2S, 5S)-tert-Butyl Edoxaban, >95% (HPLC). Offered by: Chemat Brand, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: on request, 250mg, 500mg, 50mg, 10mg, 5mg, 10mM (in 1ml dmso), 25mg.
Tert-butyl N-[(1R,2S,5S)-2-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]-5-(dimethylcarbamoyl)cyclohexyl]carbamate (CAS 480452-36-6) is a chemical compound with the molecular formula C21H30ClN5O5 and a molecular weight of 467.9 g/mol. IUPAC name: tert-butyl N-[(1R,2S,5S)-2-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]-5-(dimethylcarbamoyl)cyclohexyl]carbamate. InChIKey: YJDLJNAWLBVIRF-AEGPPILISA-N.
| Molecular formula | C21H30ClN5O5 |
|---|---|
| Molecular weight | 467.9 g/mol |
| IUPAC name | tert-butyl N-[(1R,2S,5S)-2-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]-5-(dimethylcarbamoyl)cyclohexyl]carbamate |
| InChIKey | YJDLJNAWLBVIRF-AEGPPILISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H](CC[C@@H]1NC(=O)C(=O)NC2=NC=C(C=C2)Cl)C(=O)N(C)C |
Computed by PubChem (NCBI)