CAS 4806-00-2 appears in our catalog under these names: 3-Bromofuran-2,5-dicarboxylic acid, 95%, 3-Bromofuran-2,5-dicarboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-bromofuran-2,5-dicarboxylic acid (CAS 4806-00-2) is a chemical compound with the molecular formula C6H3BrO5 and a molecular weight of 234.99 g/mol. IUPAC name: 3-bromofuran-2,5-dicarboxylic acid. InChIKey: BDMJHLXCYVWBAN-UHFFFAOYSA-N.
| Molecular formula | C6H3BrO5 |
|---|---|
| Molecular weight | 234.99 g/mol |
| IUPAC name | 3-bromofuran-2,5-dicarboxylic acid |
| InChIKey | BDMJHLXCYVWBAN-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1Br)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)