CAS 481-95-8 appears in our catalog under these names: Estriol 3-Sulfate, Estriol Impurity 19. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
[(8R,9S,13S,14S,16R,17R)-16,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] hydrogen sulfate (CAS 481-95-8) is a chemical compound with the molecular formula C18H24O6S and a molecular weight of 368.4 g/mol. IUPAC name: [(8R,9S,13S,14S,16R,17R)-16,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] hydrogen sulfate. InChIKey: ZORQMBLUMWNJEQ-ZXXIGWHRSA-N.
| Molecular formula | C18H24O6S |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | [(8R,9S,13S,14S,16R,17R)-16,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
| InChIKey | ZORQMBLUMWNJEQ-ZXXIGWHRSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1C[C@H]([C@@H]2O)O)CCC4=C3C=CC(=C4)OS(=O)(=O)O |
Computed by PubChem (NCBI)