Products 48104-28-5

CAS 48104-28-5 is the registry number for (R)-1-Phenylethylammonium bromide, 99%+(HPLC),RG, 99%+(HPLC),RG. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 3g, 5g, 25g.

Structural formula: {0} (CAS {1})

(1R)-1-phenylethanamine;hydrobromide (CAS 48104-28-5) is a chemical compound with the molecular formula C8H12BrN and a molecular weight of 202.09 g/mol. IUPAC name: (1R)-1-phenylethanamine;hydrobromide. InChIKey: FWYWEEOBVXMLRY-OGFXRTJISA-N.

Identity
Molecular formulaC8H12BrN
Molecular weight202.09 g/mol
IUPAC name(1R)-1-phenylethanamine;hydrobromide
InChIKeyFWYWEEOBVXMLRY-OGFXRTJISA-N
SMILESC[C@H](C1=CC=CC=C1)N.Br

Computed by PubChem (NCBI)