CAS 481055-29-2 appears in our catalog under these names: (S)-2-((tert-Butoxycarbonyl)amino)-3,3-bis(4-fluorophenyl)propanoic acid, 98%, Boc-L-Dip(4-F,4'-F)-OH. Offered by: Chemat Brand, Iris Biotech. Available pack sizes: on request.
(2S)-3,3-bis(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 481055-29-2) is a chemical compound with the molecular formula C20H21F2NO4 and a molecular weight of 377.4 g/mol. IUPAC name: (2S)-3,3-bis(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: LXUFYGLEWCKTKN-KRWDZBQOSA-N.
| Molecular formula | C20H21F2NO4 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | (2S)-3,3-bis(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | LXUFYGLEWCKTKN-KRWDZBQOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C(C1=CC=C(C=C1)F)C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)