CAS 48133-71-7 is the registry number for 2-[(2,6-Dichlorobenzyl)thio]ethylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
2-[(2,6-dichlorophenyl)methylsulfanyl]ethanamine (CAS 48133-71-7) is a chemical compound with the molecular formula C9H11Cl2NS and a molecular weight of 236.16 g/mol. IUPAC name: 2-[(2,6-dichlorophenyl)methylsulfanyl]ethanamine. InChIKey: VCKWYLGEZYGACK-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NS |
|---|---|
| Molecular weight | 236.16 g/mol |
| IUPAC name | 2-[(2,6-dichlorophenyl)methylsulfanyl]ethanamine |
| InChIKey | VCKWYLGEZYGACK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CSCCN)Cl |
Computed by PubChem (NCBI)