CAS 481725-36-4 appears in our catalog under these names: 4-Bromoacetyl-3-fluorophenylboronic acid, 4-Bromoacetyl-3-fluorophenylboronic acid, 95%. Offered by: Fluorochem, Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
[4-(2-bromoacetyl)-3-fluorophenyl]boronic acid (CAS 481725-36-4) is a chemical compound with the molecular formula C8H7BBrFO3 and a molecular weight of 260.85 g/mol. IUPAC name: [4-(2-bromoacetyl)-3-fluorophenyl]boronic acid. InChIKey: BXVHKBNJUHSCRF-UHFFFAOYSA-N.
| Molecular formula | C8H7BBrFO3 |
|---|---|
| Molecular weight | 260.85 g/mol |
| IUPAC name | [4-(2-bromoacetyl)-3-fluorophenyl]boronic acid |
| InChIKey | BXVHKBNJUHSCRF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)CBr)F)(O)O |
Computed by PubChem (NCBI)