CAS 482577-59-3 appears in our catalog under these names: Valsartan Impurity 19, N-((2'-Cyano(1,1'-biphenyl)-4-yl)methyl)-L-valine Methyl Ester Hydrochloride, N–(2'–Cyanobiphenyl–4–ylmethyl)–L–valine Methyl Ester Hydrochloride, N-(2'-Cyanobiphenyl-4-ylmethyl)-L-valine Methyl Ester Hydrochloride, >98.0%(HPLC)(T), N-(2'-Cyanobiphenyl-4-ylmethyl)-L-valine Methyl Ester HCl 97%. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, TCI. Available pack sizes: on request, 10g, 1g, 25mg, 100mg, 100g, 25g, 5g.
Methyl (2S)-2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-methylbutanoate;hydrochloride (CAS 482577-59-3) is a chemical compound with the molecular formula C20H23ClN2O2 and a molecular weight of 358.9 g/mol. IUPAC name: methyl (2S)-2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-methylbutanoate;hydrochloride. InChIKey: AZQXUWUZQLZNIM-FYZYNONXSA-N.
| Molecular formula | C20H23ClN2O2 |
|---|---|
| Molecular weight | 358.9 g/mol |
| IUPAC name | methyl (2S)-2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-methylbutanoate;hydrochloride |
| InChIKey | AZQXUWUZQLZNIM-FYZYNONXSA-N |
| SMILES | CC(C)[C@@H](C(=O)OC)NCC1=CC=C(C=C1)C2=CC=CC=C2C#N.Cl |
Computed by PubChem (NCBI)