CAS 4826-71-5 appears in our catalog under these names: Calcium phosphorylcholine chloride, Calcium phosphorylcholine chloride 98%, Calcium phosphorylcholine chloride, 98%. Offered by: GLPBio, Ambeed, MedChemExpress, Fluorochem. Available pack sizes: 250g, 25g, 100g, 500g, 500 g, 1 kg, 25 g, 50 g.
Calcium;2-(trimethylazaniumyl)ethyl phosphate;chloride (CAS 4826-71-5) is a chemical compound with the molecular formula C5H13CaClNO4P and a molecular weight of 257.66 g/mol. IUPAC name: calcium;2-(trimethylazaniumyl)ethyl phosphate;chloride. InChIKey: ICVPTJCCKTXCDT-UHFFFAOYSA-L.
| Molecular formula | C5H13CaClNO4P |
|---|---|
| Molecular weight | 257.66 g/mol |
| IUPAC name | calcium;2-(trimethylazaniumyl)ethyl phosphate;chloride |
| InChIKey | ICVPTJCCKTXCDT-UHFFFAOYSA-L |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])[O-].[Cl-].[Ca+2] |
Computed by PubChem (NCBI)