CAS 482617-60-7 appears in our catalog under these names: N-Cyclohexyl-n-(1,1-dioxidotetrahydrothien-3-yl)amine hydrochloride, 95%, 3-(Cyclohexylamino)tetrahydrothiophene 1,1-dioxide hydrochloride, 98%, N-​Cyclohexyltetrahydro​-​3-​thiophenamine 1,​1-​dioxide hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 0,5g.
N-cyclohexyl-1,1-dioxothiolan-3-amine;hydrochloride (CAS 482617-60-7) is a chemical compound with the molecular formula C10H20ClNO2S and a molecular weight of 253.79 g/mol. IUPAC name: N-cyclohexyl-1,1-dioxothiolan-3-amine;hydrochloride. InChIKey: CIBFQIAMLMYJDS-UHFFFAOYSA-N.
| Molecular formula | C10H20ClNO2S |
|---|---|
| Molecular weight | 253.79 g/mol |
| IUPAC name | N-cyclohexyl-1,1-dioxothiolan-3-amine;hydrochloride |
| InChIKey | CIBFQIAMLMYJDS-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC2CCS(=O)(=O)C2.Cl |
Computed by PubChem (NCBI)