CAS 483-91-0 appears in our catalog under these names: Isofraxidin 7-O-beta-D-Glucoside, Calycanthoside/ 99.69% (existing batch purity), Calycanthoside. Offered by: TRC, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 20mg, 1 mg, 5 mg.
6,8-dimethoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one (CAS 483-91-0) is a chemical compound with the molecular formula C17H20O10 and a molecular weight of 384.3 g/mol. IUPAC name: 6,8-dimethoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one. InChIKey: IKUQEFGEUOOPGY-QSDFBURQSA-N.
| Molecular formula | C17H20O10 |
|---|---|
| Molecular weight | 384.3 g/mol |
| IUPAC name | 6,8-dimethoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
| InChIKey | IKUQEFGEUOOPGY-QSDFBURQSA-N |
| SMILES | COC1=C(C(=C2C(=C1)C=CC(=O)O2)OC)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
Computed by PubChem (NCBI)