CAS 4833-56-1 is the registry number for Homopteroic Acid. Offered by: TRC, TargetMol. Available pack sizes: 250mg, 25mg, 50mg, 100mg.
4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethylamino]benzoic acid (CAS 4833-56-1) is a chemical compound with the molecular formula C15H14N6O3 and a molecular weight of 326.31 g/mol. IUPAC name: 4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethylamino]benzoic acid. InChIKey: DTDQDDMTACYSOK-UHFFFAOYSA-N.
| Molecular formula | C15H14N6O3 |
|---|---|
| Molecular weight | 326.31 g/mol |
| IUPAC name | 4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethylamino]benzoic acid |
| InChIKey | DTDQDDMTACYSOK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)NCCC2=CN=C3C(=N2)C(=O)NC(=N3)N |
Computed by PubChem (NCBI)