Products 483340-20-1
CAS 483340-20-1 appears in our catalog under these names: Isavuconazole Impurity 42, Isavuconazole Impurity 22. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(3R,4R)-4-(2,5-difluorophenyl)-3-methyl-4-(1,2,4-triazol-1-ylmethyl)oxetan-2-one (CAS 483340-20-1) is a chemical compound with the molecular formula C13H11F2N3O2 and a molecular weight of 279.24 g/mol. IUPAC name: (3R,4R)-4-(2,5-difluorophenyl)-3-methyl-4-(1,2,4-triazol-1-ylmethyl)oxetan-2-one. InChIKey: BLVZJTXQMVLLME-ISVAXAHUSA-N.
| Molecular formula | C13H11F2N3O2 |
|---|---|
| Molecular weight | 279.24 g/mol |
| IUPAC name | (3R,4R)-4-(2,5-difluorophenyl)-3-methyl-4-(1,2,4-triazol-1-ylmethyl)oxetan-2-one |
| InChIKey | BLVZJTXQMVLLME-ISVAXAHUSA-N |
| SMILES | C[C@H]1C(=O)O[C@@]1(CN2C=NC=N2)C3=C(C=CC(=C3)F)F |
Computed by PubChem (NCBI)