CAS 484-47-9 appears in our catalog under these names: 2,4,5–Triphenylimidazole, Lophine/ 99.98% (existing batch purity), 2,4,5-Triphenylimidazole, 97% , 2,4,5-Triphenylimidazole, 2,4,5-Triphenylimidazole, >98.0%(HPLC)(T). Offered by: GLPBio, TargetMol, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 100g, 10g, 25g, 50g, 100mg, 250g, 0,01kg, 0,005kg.
2,4,5-triphenyl-1H-imidazole (CAS 484-47-9) is a chemical compound with the molecular formula C21H16N2 and a molecular weight of 296.4 g/mol. IUPAC name: 2,4,5-triphenyl-1H-imidazole. InChIKey: RNIPJYFZGXJSDD-UHFFFAOYSA-N.
| Molecular formula | C21H16N2 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | 2,4,5-triphenyl-1H-imidazole |
| InChIKey | RNIPJYFZGXJSDD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(N2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)