Products 484-58-2
CAS 484-58-2 appears in our catalog under these names: Neoagarobiose, 2 mg, Neoagarobiose, >95% (HPLC), Neoagarobiose, Neoagarobiose, 5 mg, Neoagarobiose, 10 mg. Offered by: Roth, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 2mg, 25mg, 10mg, 5mg, 50mg, 100mg, 25 mg, 50 mg.
(2R,3S,4S,5R)-3-[[(1S,3S,4S,5R)-4,8-dihydroxy-2,6-dioxabicyclo[3.2.1]octan-3-yl]oxy]-2,4,5,6-tetrahydroxyhexanal (CAS 484-58-2) is a chemical compound with the molecular formula C12H20O10 and a molecular weight of 324.28 g/mol. IUPAC name: (2R,3S,4S,5R)-3-[[(1S,3S,4S,5R)-4,8-dihydroxy-2,6-dioxabicyclo[3.2.1]octan-3-yl]oxy]-2,4,5,6-tetrahydroxyhexanal. InChIKey: ILLZAAKBNPACJI-UOFVWDQCSA-N.
| Molecular formula | C12H20O10 |
|---|---|
| Molecular weight | 324.28 g/mol |
| IUPAC name | (2R,3S,4S,5R)-3-[[(1S,3S,4S,5R)-4,8-dihydroxy-2,6-dioxabicyclo[3.2.1]octan-3-yl]oxy]-2,4,5,6-tetrahydroxyhexanal |
| InChIKey | ILLZAAKBNPACJI-UOFVWDQCSA-N |
| SMILES | C1[C@H]2C([C@@H](O1)[C@@H]([C@@H](O2)O[C@H]([C@H](C=O)O)[C@H]([C@@H](CO)O)O)O)O |
Computed by PubChem (NCBI)