Products 484006-66-8
CAS 484006-66-8 appears in our catalog under these names: β-Glucuronidase-IN-1/ 98.05% (existing batch purity), β–Glucuronidase–IN–1, β-Glucuronidase-IN-1 98%, β-Glucuronidase-IN-1, 98.05% ,, 98.05% ,, β-Glucuronidase-IN-1, 98.21%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(2-hydroxyethyl)thiourea (CAS 484006-66-8) is a chemical compound with the molecular formula C23H27N3O3S and a molecular weight of 425.5 g/mol. IUPAC name: 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(2-hydroxyethyl)thiourea. InChIKey: PSKUPWXOVUAUJD-UHFFFAOYSA-N.
| Molecular formula | C23H27N3O3S |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(2-hydroxyethyl)thiourea |
| InChIKey | PSKUPWXOVUAUJD-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)NC(=S)N(CCO)CC2=CC3=CC(=CC(=C3NC2=O)C)C |
Computed by PubChem (NCBI)