CAS 4852-81-7 is the registry number for 2-BENZOYL-3H-BENZO[F]CHROMEN-3-ONE, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2-benzoylbenzo[f]chromen-3-one (CAS 4852-81-7) is a chemical compound with the molecular formula C20H12O3 and a molecular weight of 300.3 g/mol. IUPAC name: 2-benzoylbenzo[f]chromen-3-one. InChIKey: JPPGTVYDWHSNLJ-UHFFFAOYSA-N.
| Molecular formula | C20H12O3 |
|---|---|
| Molecular weight | 300.3 g/mol |
| IUPAC name | 2-benzoylbenzo[f]chromen-3-one |
| InChIKey | JPPGTVYDWHSNLJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC3=C(C=CC4=CC=CC=C43)OC2=O |
Computed by PubChem (NCBI)