CAS 485334-94-9 appears in our catalog under these names: ([5-(2-Thienyl)-1,3,4-oxadiazol-2-yl]thio)acetic acid, 95%, 2-((5-(Thiophen-2-yl)-1,3,4-oxadiazol-2-yl)thio)acetic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 5g, 1g.
2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid (CAS 485334-94-9) is a chemical compound with the molecular formula C8H6N2O3S2 and a molecular weight of 242.3 g/mol. IUPAC name: 2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid. InChIKey: DDAZVWRCOLWHLI-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3S2 |
|---|---|
| Molecular weight | 242.3 g/mol |
| IUPAC name | 2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid |
| InChIKey | DDAZVWRCOLWHLI-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NN=C(O2)SCC(=O)O |
Computed by PubChem (NCBI)