CAS 4857-70-9 appears in our catalog under these names: 2,5-Cyclohexadiene-1,4-dione, 2-(1,1-dimethylethyl)-5-hydroxy-, 95%, 2-(tert-Butyl)-5-hydroxycyclohexa-2,5-diene-1,4-dione, 98%, 2–(tert–Butyl)–5–hydroxycyclohexa–2，5–diene–1，4–dione, 2-(tert-Butyl)-5-hydroxycyclohexa-2,5-diene-1,4-dione, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-tert-butyl-5-hydroxycyclohexa-3,5-diene-1,2-dione (CAS 4857-70-9) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 4-tert-butyl-5-hydroxycyclohexa-3,5-diene-1,2-dione. InChIKey: PUHREJGNFIKMHT-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 4-tert-butyl-5-hydroxycyclohexa-3,5-diene-1,2-dione |
| InChIKey | PUHREJGNFIKMHT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=O)C(=O)C=C1O |
Computed by PubChem (NCBI)