CAS 4858-38-2 appears in our catalog under these names: 5-{((4-chlorophenyl)methyl)sulfanyl}-1,3,4-thiadiazole-2-thiol, 95%, 5-{((4-Chlorophenyl)methyl)sulfanyl}-1,3,4-thiadiazole-2-thiol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
5-[(4-chlorophenyl)methylsulfanyl]-3H-1,3,4-thiadiazole-2-thione (CAS 4858-38-2) is a chemical compound with the molecular formula C9H7ClN2S3 and a molecular weight of 274.8 g/mol. IUPAC name: 5-[(4-chlorophenyl)methylsulfanyl]-3H-1,3,4-thiadiazole-2-thione. InChIKey: SYOQAFMUNJKGFW-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2S3 |
|---|---|
| Molecular weight | 274.8 g/mol |
| IUPAC name | 5-[(4-chlorophenyl)methylsulfanyl]-3H-1,3,4-thiadiazole-2-thione |
| InChIKey | SYOQAFMUNJKGFW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CSC2=NNC(=S)S2)Cl |
Computed by PubChem (NCBI)