CAS 486994-01-8 is the registry number for 5-Bromo-4-formyl-2-methoxyphenyl benzoate. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
(5-bromo-4-formyl-2-methoxyphenyl) benzoate (CAS 486994-01-8) is a chemical compound with the molecular formula C15H11BrO4 and a molecular weight of 335.15 g/mol. IUPAC name: (5-bromo-4-formyl-2-methoxyphenyl) benzoate. InChIKey: UHFPZIFKHUTALX-UHFFFAOYSA-N.
| Molecular formula | C15H11BrO4 |
|---|---|
| Molecular weight | 335.15 g/mol |
| IUPAC name | (5-bromo-4-formyl-2-methoxyphenyl) benzoate |
| InChIKey | UHFPZIFKHUTALX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=O)Br)OC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)