CAS 486997-73-3 is the registry number for 3-Chloro-5-((3-methoxybenzyl)sulfinyl)-1,2,4-thiadiazole, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3-chloro-5-[(3-methoxyphenyl)methylsulfinyl]-1,2,4-thiadiazole (CAS 486997-73-3) is a chemical compound with the molecular formula C10H9ClN2O2S2 and a molecular weight of 288.8 g/mol. IUPAC name: 3-chloro-5-[(3-methoxyphenyl)methylsulfinyl]-1,2,4-thiadiazole. InChIKey: GLVXYXUHKMWNCC-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2S2 |
|---|---|
| Molecular weight | 288.8 g/mol |
| IUPAC name | 3-chloro-5-[(3-methoxyphenyl)methylsulfinyl]-1,2,4-thiadiazole |
| InChIKey | GLVXYXUHKMWNCC-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)CS(=O)C2=NC(=NS2)Cl |
Computed by PubChem (NCBI)