CAS 488-82-4 appears in our catalog under these names: D-Arabinitol, 95%, D-Arabinitol, D-Arabinitol, >95% (HPLC), D-Arabitol, D-Arabitol/ 98%. Offered by: Combi-blocks, Chemat Brand, TRC, Dr. Ehrenstorfer, TargetMol. Available pack sizes: 25g, 500g, 100g, 5g, 1g, on request, 10g, 50g.
(2R,4R)-pentane-1,2,3,4,5-pentol (CAS 488-82-4) is a chemical compound with the molecular formula C5H12O5 and a molecular weight of 152.15 g/mol. IUPAC name: (2R,4R)-pentane-1,2,3,4,5-pentol. InChIKey: HEBKCHPVOIAQTA-QWWZWVQMSA-N.
| Molecular formula | C5H12O5 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | (2R,4R)-pentane-1,2,3,4,5-pentol |
| InChIKey | HEBKCHPVOIAQTA-QWWZWVQMSA-N |
| SMILES | C([C@H](C([C@@H](CO)O)O)O)O |
Computed by PubChem (NCBI)