CAS 488122-76-5 appears in our catalog under these names: 4-(Piperazine-1-sulfonyl)-2,1,3-benzothiadiazole, 95%, 4-(Piperazine-1-sulfonyl)-2,1,3-benzothiadiazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
4-piperazin-1-ylsulfonyl-2,1,3-benzothiadiazole (CAS 488122-76-5) is a chemical compound with the molecular formula C10H12N4O2S2 and a molecular weight of 284.4 g/mol. IUPAC name: 4-piperazin-1-ylsulfonyl-2,1,3-benzothiadiazole. InChIKey: DPNIKKVQBHVYMT-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O2S2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | 4-piperazin-1-ylsulfonyl-2,1,3-benzothiadiazole |
| InChIKey | DPNIKKVQBHVYMT-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=CC=CC3=NSN=C32 |
Computed by PubChem (NCBI)