CAS 4883-72-1 is the registry number for N-Nitroso N-Hydroxy Cyclohexanamine. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 100mg.
(Z)-cyclohexyl-hydroxyimino-oxidoazanium (CAS 4883-72-1) is a chemical compound with the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. IUPAC name: (Z)-cyclohexyl-hydroxyimino-oxidoazanium. InChIKey: BRWAZZQVWBDAER-FPLPWBNLSA-N.
| Molecular formula | C6H12N2O2 |
|---|---|
| Molecular weight | 144.17 g/mol |
| IUPAC name | (Z)-cyclohexyl-hydroxyimino-oxidoazanium |
| InChIKey | BRWAZZQVWBDAER-FPLPWBNLSA-N |
| SMILES | C1CCC(CC1)/[N+](=N/O)/[O-] |
Computed by PubChem (NCBI)