CAS 4885-93-2 is the registry number for (Dimercaptomethylene)malononitrile disodium salt, 97%, 97%. Offered by: Chemat. Available pack sizes: 500mg.
Disodium;2,2-dicyanoethene-1,1-dithiolate (CAS 4885-93-2) is a chemical compound with the molecular formula C4N2Na2S2 and a molecular weight of 186.2 g/mol. IUPAC name: disodium;2,2-dicyanoethene-1,1-dithiolate. InChIKey: VHVPPDQPTYJSNO-UHFFFAOYSA-L.
| Molecular formula | C4N2Na2S2 |
|---|---|
| Molecular weight | 186.2 g/mol |
| IUPAC name | disodium;2,2-dicyanoethene-1,1-dithiolate |
| InChIKey | VHVPPDQPTYJSNO-UHFFFAOYSA-L |
| SMILES | C(#N)C(=C([S-])[S-])C#N.[Na+].[Na+] |
Computed by PubChem (NCBI)