Products 4886-15-1

CAS 4886-15-1 is the registry number for Bis(methylsulfanyl)-1,2-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

3,5-bis(methylsulfanyl)-1,2-thiazole-4-carboxylic acid (CAS 4886-15-1) is a chemical compound with the molecular formula C6H7NO2S3 and a molecular weight of 221.3 g/mol. IUPAC name: 3,5-bis(methylsulfanyl)-1,2-thiazole-4-carboxylic acid. InChIKey: IQFPLSISGDGBMJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7NO2S3
Molecular weight221.3 g/mol
IUPAC name3,5-bis(methylsulfanyl)-1,2-thiazole-4-carboxylic acid
InChIKeyIQFPLSISGDGBMJ-UHFFFAOYSA-N
SMILESCSC1=C(C(=NS1)SC)C(=O)O

Computed by PubChem (NCBI)