CAS 488761-06-4 appears in our catalog under these names: Fmoc-(s)-phenyl-l-cys, 95%, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(phenyl)amino)-3-mercaptopropanoic acid, 97%, Fmoc-L-Cys(Ph)-OH. Offered by: Combi-blocks, AmBeed, Iris Biotech. Available pack sizes: 1g, 250mg, 100mg.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylsulfanylpropanoic acid (CAS 488761-06-4) is a chemical compound with the molecular formula C24H21NO4S and a molecular weight of 419.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylsulfanylpropanoic acid. InChIKey: NEPLBXLAJXQDSK-QFIPXVFZSA-N.
| Molecular formula | C24H21NO4S |
|---|---|
| Molecular weight | 419.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylsulfanylpropanoic acid |
| InChIKey | NEPLBXLAJXQDSK-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C=C1)SC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)