Products 4893-00-9
CAS 4893-00-9 is the registry number for Dispiro(3.1.3.1)​decane-​5,​10-​dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Dispiro[3.1.36.14]decane-5,10-dione (CAS 4893-00-9) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. IUPAC name: dispiro[3.1.36.14]decane-5,10-dione. InChIKey: VFHGYGWDEXAIAE-UHFFFAOYSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 164.20 g/mol |
| IUPAC name | dispiro[3.1.36.14]decane-5,10-dione |
| InChIKey | VFHGYGWDEXAIAE-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)C(=O)C3(C2=O)CCC3 |
Computed by PubChem (NCBI)
Synonyms:
Dispiro(3.1.3.1)decane-5,10-dione, Dispiro[3.1.3.1]decane-5,10-dione, dispiro[3.1.3^{6}.1^{4}]decane-5,10-dione, dispiro(3.1.3^(6).1^(4))decane-5,10-dione, dispiro[3.1.36.14]decane-5,10-dione, Dispiro[3.1.3.1]?decane-?5,?10-?dione, dispiro[3.1.3(6).1(4)]decane-5,10-dione, Dispiro[3.1.3~6~.1~4~]decane-5,10-dione