Products 489425-91-4
CAS 489425-91-4 is the registry number for 6-Methyl-4-(trifluoromethyl)thieno[2,3-b]pyridin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-methyl-4-(trifluoromethyl)thieno[2,3-b]pyridin-3-amine (CAS 489425-91-4) is a chemical compound with the molecular formula C9H7F3N2S and a molecular weight of 232.23 g/mol. IUPAC name: 6-methyl-4-(trifluoromethyl)thieno[2,3-b]pyridin-3-amine. InChIKey: SEZWXHACLVIANI-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2S |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 6-methyl-4-(trifluoromethyl)thieno[2,3-b]pyridin-3-amine |
| InChIKey | SEZWXHACLVIANI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=CSC2=N1)N)C(F)(F)F |
Computed by PubChem (NCBI)