CAS 489433-67-2 is the registry number for 2,2'-(2,2-Dimethyl-1,3-dioxolane-4,5-diyl)bis(propan-2-ol), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[5-(2-hydroxypropan-2-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-ol (CAS 489433-67-2) is a chemical compound with the molecular formula C11H22O4 and a molecular weight of 218.29 g/mol. IUPAC name: 2-[5-(2-hydroxypropan-2-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-ol. InChIKey: KJORNJHCUSQRDY-UHFFFAOYSA-N.
| Molecular formula | C11H22O4 |
|---|---|
| Molecular weight | 218.29 g/mol |
| IUPAC name | 2-[5-(2-hydroxypropan-2-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-ol |
| InChIKey | KJORNJHCUSQRDY-UHFFFAOYSA-N |
| SMILES | CC1(OC(C(O1)C(C)(C)O)C(C)(C)O)C |
Computed by PubChem (NCBI)