CAS 490-06-2 appears in our catalog under these names: 3-Isopropyl-6-methylbenzene-1,2-diol, 3-Isopropyl-6-methylbenzene-1,2-diol, 97%, 97%, 3-Isopropyl-6-methylbenzene-1,2-diol, 97%. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 25mg, 100mg, 250mg, 50mg, 500mg, 1g.
3-methyl-6-propan-2-ylbenzene-1,2-diol (CAS 490-06-2) is a chemical compound with the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. IUPAC name: 3-methyl-6-propan-2-ylbenzene-1,2-diol. InChIKey: LYUBXLHGANLIMX-UHFFFAOYSA-N.
| Molecular formula | C10H14O2 |
|---|---|
| Molecular weight | 166.22 g/mol |
| IUPAC name | 3-methyl-6-propan-2-ylbenzene-1,2-diol |
| InChIKey | LYUBXLHGANLIMX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(C)C)O)O |
Computed by PubChem (NCBI)