Products 490-93-7
CAS 490-93-7 is the registry number for 1,4-Cyclohexanedione-2,5-Dicarboxylic Acid. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-dioxocyclohexane-1,4-dicarboxylic acid (CAS 490-93-7) is a chemical compound with the molecular formula C8H8O6 and a molecular weight of 200.14 g/mol. IUPAC name: 2,5-dioxocyclohexane-1,4-dicarboxylic acid. InChIKey: MWOCXYMRORNPPM-UHFFFAOYSA-N.
| Molecular formula | C8H8O6 |
|---|---|
| Molecular weight | 200.14 g/mol |
| IUPAC name | 2,5-dioxocyclohexane-1,4-dicarboxylic acid |
| InChIKey | MWOCXYMRORNPPM-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)CC(C1=O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)