Products 490034-49-6
CAS 490034-49-6 appears in our catalog under these names: DL-3-phenyllactic Acid-d3, >95% (HPLC), DL–3–Phenyllactic acid–d3, DL-3-Phenyllactic acid-d3, 99.33%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 5mg, 500μg, 1mg, 500 μg, 1 mg.
2,3,3-trideuterio-2-hydroxy-3-phenylpropanoic acid (CAS 490034-49-6) is a chemical compound with the molecular formula C9H10O3 and a molecular weight of 169.19 g/mol. IUPAC name: 2,3,3-trideuterio-2-hydroxy-3-phenylpropanoic acid. InChIKey: VOXXWSYKYCBWHO-OJYSAGIRSA-N.
| Molecular formula | C9H10O3 |
|---|---|
| Molecular weight | 169.19 g/mol |
| IUPAC name | 2,3,3-trideuterio-2-hydroxy-3-phenylpropanoic acid |
| InChIKey | VOXXWSYKYCBWHO-OJYSAGIRSA-N |
| SMILES | [2H]C([2H])(C1=CC=CC=C1)C([2H])(C(=O)O)O |
Computed by PubChem (NCBI)