CAS 4905-71-9 appears in our catalog under these names: Ethyl 2-(1,1-dioxidotetrahydrothiophen-3-yl)-3-oxobutanoate, 98%, α-​Acetyltetrahydro-3-​thiopheneacetic acid ethyl ester 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 2,5g, 250mg.
Ethyl 2-(1,1-dioxothiolan-3-yl)-3-oxobutanoate (CAS 4905-71-9) is a chemical compound with the molecular formula C10H16O5S and a molecular weight of 248.30 g/mol. IUPAC name: ethyl 2-(1,1-dioxothiolan-3-yl)-3-oxobutanoate. InChIKey: WINWJOBODCLFQL-UHFFFAOYSA-N.
| Molecular formula | C10H16O5S |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | ethyl 2-(1,1-dioxothiolan-3-yl)-3-oxobutanoate |
| InChIKey | WINWJOBODCLFQL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1CCS(=O)(=O)C1)C(=O)C |
Computed by PubChem (NCBI)