CAS 491593-36-3 appears in our catalog under these names: (2R,3S,4R,5S,6S)–2–(2–chloroethoxy)–6–methyltetrahydro–2H–pyran–3,4,5–triol, 2-Chloroethyl α-L-fucopyranoside. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 50mg, 500mg.
(2R,3S,4R,5S,6S)-2-(2-chloroethoxy)-6-methyloxane-3,4,5-triol (CAS 491593-36-3) is a chemical compound with the molecular formula C8H15ClO5 and a molecular weight of 226.65 g/mol. IUPAC name: (2R,3S,4R,5S,6S)-2-(2-chloroethoxy)-6-methyloxane-3,4,5-triol. InChIKey: NVKRALSJYXPFIY-FMGWEMOISA-N.
| Molecular formula | C8H15ClO5 |
|---|---|
| Molecular weight | 226.65 g/mol |
| IUPAC name | (2R,3S,4R,5S,6S)-2-(2-chloroethoxy)-6-methyloxane-3,4,5-triol |
| InChIKey | NVKRALSJYXPFIY-FMGWEMOISA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)OCCCl)O)O)O |
Computed by PubChem (NCBI)