Products 491611-67-7
CAS 491611-67-7 is the registry number for MRS2496. Offered by: MedChemExpress. Available pack sizes: Get quote.
[2-[[2-chloro-6-(methylamino)purin-9-yl]methyl]-3-phosphonopropyl]phosphonic acid (CAS 491611-67-7) is a chemical compound with the molecular formula C10H16ClN5O6P2 and a molecular weight of 399.66 g/mol. IUPAC name: [2-[[2-chloro-6-(methylamino)purin-9-yl]methyl]-3-phosphonopropyl]phosphonic acid. InChIKey: FFBIISIICFTESN-UHFFFAOYSA-N.
| Molecular formula | C10H16ClN5O6P2 |
|---|---|
| Molecular weight | 399.66 g/mol |
| IUPAC name | [2-[[2-chloro-6-(methylamino)purin-9-yl]methyl]-3-phosphonopropyl]phosphonic acid |
| InChIKey | FFBIISIICFTESN-UHFFFAOYSA-N |
| SMILES | CNC1=C2C(=NC(=N1)Cl)N(C=N2)CC(CP(=O)(O)O)CP(=O)(O)O |
Computed by PubChem (NCBI)