CAS 4917-76-4 appears in our catalog under these names: Thiodisuccinic acid, 98%, Thiodisuccinic Acid, 2,2'-Thiodisuccinic acid 98%, 2,2'-Thiodisuccinic acid, 97%, 97%, 2,2'-Thiodisuccinic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 25g, 1g, 50g, 10g.
2-(1,2-dicarboxyethylsulfanyl)butanedioic acid (CAS 4917-76-4) is a chemical compound with the molecular formula C8H10O8S and a molecular weight of 266.23 g/mol. IUPAC name: 2-(1,2-dicarboxyethylsulfanyl)butanedioic acid. InChIKey: SASYRHXVHLPMQD-UHFFFAOYSA-N.
| Molecular formula | C8H10O8S |
|---|---|
| Molecular weight | 266.23 g/mol |
| IUPAC name | 2-(1,2-dicarboxyethylsulfanyl)butanedioic acid |
| InChIKey | SASYRHXVHLPMQD-UHFFFAOYSA-N |
| SMILES | C(C(C(=O)O)SC(CC(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)