Products 491843-18-6

CAS 491843-18-6 is the registry number for N-(3-Bromophenyl)-n-(phenylsulfonyl)glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[N-(benzenesulfonyl)-3-bromoanilino]acetic acid (CAS 491843-18-6) is a chemical compound with the molecular formula C14H12BrNO4S and a molecular weight of 370.22 g/mol. IUPAC name: 2-[N-(benzenesulfonyl)-3-bromoanilino]acetic acid. InChIKey: FVFIDMHABTUZKO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12BrNO4S
Molecular weight370.22 g/mol
IUPAC name2-[N-(benzenesulfonyl)-3-bromoanilino]acetic acid
InChIKeyFVFIDMHABTUZKO-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)S(=O)(=O)N(CC(=O)O)C2=CC(=CC=C2)Br

Computed by PubChem (NCBI)