CAS 491873-61-1 is the registry number for 2-(4-Chlorophenyl)-5-((4H-1,2,4-triazol-3-ylsulfanyl)methyl)-1,3,4-oxadiazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(4-chlorophenyl)-5-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3,4-oxadiazole (CAS 491873-61-1) is a chemical compound with the molecular formula C11H8ClN5OS and a molecular weight of 293.73 g/mol. IUPAC name: 2-(4-chlorophenyl)-5-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3,4-oxadiazole. InChIKey: IKHFQGWMPIFEHU-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN5OS |
|---|---|
| Molecular weight | 293.73 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-5-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3,4-oxadiazole |
| InChIKey | IKHFQGWMPIFEHU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)CSC3=NC=NN3)Cl |
Computed by PubChem (NCBI)