CAS 491875-99-1 is the registry number for 3-(4-Fluorophenyl)-5-methyl-1,2-oxazole. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-(4-fluorophenyl)-5-methyl-1,2-oxazole (CAS 491875-99-1) is a chemical compound with the molecular formula C10H8FNO and a molecular weight of 177.17 g/mol. IUPAC name: 3-(4-fluorophenyl)-5-methyl-1,2-oxazole. InChIKey: LHFLXLRCDZEKPV-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO |
|---|---|
| Molecular weight | 177.17 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-5-methyl-1,2-oxazole |
| InChIKey | LHFLXLRCDZEKPV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)