CAS 492442-28-1 appears in our catalog under these names: 2-(5-Chlorothien-2-yl)-6-methylquinoline-4-carboxylic acid, 95%, 2-(5-Chlorothiophen-2-yl)-6-methylquinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(5-chlorothiophen-2-yl)-6-methylquinoline-4-carboxylic acid (CAS 492442-28-1) is a chemical compound with the molecular formula C15H10ClNO2S and a molecular weight of 303.8 g/mol. IUPAC name: 2-(5-chlorothiophen-2-yl)-6-methylquinoline-4-carboxylic acid. InChIKey: TTZPXRKMYUVDOO-UHFFFAOYSA-N.
| Molecular formula | C15H10ClNO2S |
|---|---|
| Molecular weight | 303.8 g/mol |
| IUPAC name | 2-(5-chlorothiophen-2-yl)-6-methylquinoline-4-carboxylic acid |
| InChIKey | TTZPXRKMYUVDOO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(C=C2C(=O)O)C3=CC=C(S3)Cl |
Computed by PubChem (NCBI)