CAS 492468-13-0 is the registry number for Ethyl (1R,2R)-2-cyanocyclopropane-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
Cis-ethyl (1R,2R)-2-cyanocyclopropane-1-carboxylate (CAS 492468-13-0) is a chemical compound with the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. IUPAC name: cis-ethyl (1R,2R)-2-cyanocyclopropane-1-carboxylate. InChIKey: ABSAAQSCUQHJOC-NTSWFWBYSA-N.
| Molecular formula | C7H9NO2 |
|---|---|
| Molecular weight | 139.15 g/mol |
| IUPAC name | cis-ethyl (1R,2R)-2-cyanocyclopropane-1-carboxylate |
| InChIKey | ABSAAQSCUQHJOC-NTSWFWBYSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@H]1C#N |
Computed by PubChem (NCBI)