CAS 493-53-8 is the registry number for Acetylsalicylic Acid Sodium Salt. Offered by: TRC, Biosynth. Available pack sizes: 10g, 250mg.
CAS 493-53-8 identifies a chemical compound with the molecular formula C9H8NaO4 and a molecular weight of 203.15 g/mol. InChIKey: DCNFJXWUPHHBKG-UHFFFAOYSA-N.
| Molecular formula | C9H8NaO4 |
|---|---|
| Molecular weight | 203.15 g/mol |
| InChIKey | DCNFJXWUPHHBKG-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC=C1C(=O)O.[Na] |
Computed by PubChem (NCBI)