CAS 493-57-2 appears in our catalog under these names: Benzo[b]thiophene-2,3-dione, 95%, Thionaphthenquinone, >95% (HPLC), Thionaphthenquinone 95%, Benzo[b]thiophene-2,3-dione, 95%, 95%, Benzo[b]thiophene-2,3-dione, 97%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg.
1-benzothiophene-2,3-dione (CAS 493-57-2) is a chemical compound with the molecular formula C8H4O2S and a molecular weight of 164.18 g/mol. IUPAC name: 1-benzothiophene-2,3-dione. InChIKey: MHESOLAAORBNPM-UHFFFAOYSA-N.
| Molecular formula | C8H4O2S |
|---|---|
| Molecular weight | 164.18 g/mol |
| IUPAC name | 1-benzothiophene-2,3-dione |
| InChIKey | MHESOLAAORBNPM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=O)S2 |
Computed by PubChem (NCBI)