CAS 4945-42-0 is the registry number for Furo[3,4-b]quinoline-1,3-dione, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Furo[3,4-b]quinoline-1,3-dione (CAS 4945-42-0) is a chemical compound with the molecular formula C11H5NO3 and a molecular weight of 199.16 g/mol. IUPAC name: furo[3,4-b]quinoline-1,3-dione. InChIKey: NLVZUORLSQCGFQ-UHFFFAOYSA-N.
| Molecular formula | C11H5NO3 |
|---|---|
| Molecular weight | 199.16 g/mol |
| IUPAC name | furo[3,4-b]quinoline-1,3-dione |
| InChIKey | NLVZUORLSQCGFQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C(=N2)C(=O)OC3=O |
Computed by PubChem (NCBI)