CAS 494762-08-2 appears in our catalog under these names: 3-(2-Chloro-6-fluorophenyl)-1-(4-chlorophenyl)prop-2-en-1-one, 97%, (2E)-3-(2-Chloro-6-fluorophenyl)-1-(4-chlorophenyl)prop-2-en-1-one, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(E)-3-(2-chloro-6-fluorophenyl)-1-(4-chlorophenyl)prop-2-en-1-one (CAS 494762-08-2) is a chemical compound with the molecular formula C15H9Cl2FO and a molecular weight of 295.1 g/mol. IUPAC name: (E)-3-(2-chloro-6-fluorophenyl)-1-(4-chlorophenyl)prop-2-en-1-one. InChIKey: GSXALLLVZAXTNH-CMDGGOBGSA-N.
| Molecular formula | C15H9Cl2FO |
|---|---|
| Molecular weight | 295.1 g/mol |
| IUPAC name | (E)-3-(2-chloro-6-fluorophenyl)-1-(4-chlorophenyl)prop-2-en-1-one |
| InChIKey | GSXALLLVZAXTNH-CMDGGOBGSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)/C=C/C(=O)C2=CC=C(C=C2)Cl)F |
Computed by PubChem (NCBI)