CAS 494786-13-9 is the registry number for DCG066, 99.78%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 25 mg, 10 mg, 1 mg, 50 mg, 5 mg, 10mM/1mL.
3-[4-[[4-[hydroxy-bis[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]methyl]phenyl]-1,1-dimethylurea (CAS 494786-13-9) is a chemical compound with the molecular formula C30H31F6N3O2 and a molecular weight of 579.6 g/mol. IUPAC name: 3-[4-[[4-[hydroxy-bis[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]methyl]phenyl]-1,1-dimethylurea. InChIKey: PMPKMTDYPOAEEH-UHFFFAOYSA-N.
| Molecular formula | C30H31F6N3O2 |
|---|---|
| Molecular weight | 579.6 g/mol |
| IUPAC name | 3-[4-[[4-[hydroxy-bis[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]methyl]phenyl]-1,1-dimethylurea |
| InChIKey | PMPKMTDYPOAEEH-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)NC1=CC=C(C=C1)CN2CCC(CC2)C(C3=CC=C(C=C3)C(F)(F)F)(C4=CC=C(C=C4)C(F)(F)F)O |
Computed by PubChem (NCBI)