CAS 4948-29-2 is the registry number for trans-2-Pinanol, >95% (GC). Offered by: TRC. Available pack sizes: 10mg, 25mg.
(1R,2R,5S)-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol (CAS 4948-29-2) is a chemical compound with the molecular formula C10H18O and a molecular weight of 154.25 g/mol. IUPAC name: (1R,2R,5S)-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol. InChIKey: YYWZKGZIIKPPJZ-QXFUBDJGSA-N.
| Molecular formula | C10H18O |
|---|---|
| Molecular weight | 154.25 g/mol |
| IUPAC name | (1R,2R,5S)-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol |
| InChIKey | YYWZKGZIIKPPJZ-QXFUBDJGSA-N |
| SMILES | C[C@]1(CC[C@H]2C[C@@H]1C2(C)C)O |
Computed by PubChem (NCBI)