CAS 494844-07-4 appears in our catalog under these names: NESS 0327, NESS 0327/ 99.74% (existing batch purity), NESS 0327, NESS 0327, ≥98%(HPLC), ≥98%(HPLC), NESS 0327, 99.22%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg.
12-chloro-3-(2,4-dichlorophenyl)-N-piperidin-1-yl-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaene-5-carboxamide (CAS 494844-07-4) is a chemical compound with the molecular formula C24H23Cl3N4O and a molecular weight of 489.8 g/mol. IUPAC name: 12-chloro-3-(2,4-dichlorophenyl)-N-piperidin-1-yl-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaene-5-carboxamide. InChIKey: NCXBPZJQQSNIRA-UHFFFAOYSA-N.
| Molecular formula | C24H23Cl3N4O |
|---|---|
| Molecular weight | 489.8 g/mol |
| IUPAC name | 12-chloro-3-(2,4-dichlorophenyl)-N-piperidin-1-yl-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaene-5-carboxamide |
| InChIKey | NCXBPZJQQSNIRA-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)NC(=O)C2=NN(C3=C2CCCC4=C3C=CC(=C4)Cl)C5=C(C=C(C=C5)Cl)Cl |
Computed by PubChem (NCBI)